C21H16F4N6O — CID 118969076
(9S)-N-(3-fluoro-4-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969076) has the molecular formula C21H16F4N6O and a molecular weight of 444.39 g/mol. Its IUPAC name is (9S)-N-(3-fluoro-4-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(3-fluoro-4-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969076 |
| Molecular Formula | C21H16F4N6O |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (9S)-N-(3-fluoro-4-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccncc1F)N1c2nc(-c3ccnc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C21H16F4N6O/c22-14-10-26-6-4-16(14)29-20(32)31-13-5-8-30(11-13)17-2-1-15(28-19(17)31)12-3-7-27-18(9-12)21(23,24)25/h1-4,6-7,9-10,13H,5,8,11H2,(H,26,29,32)/t13-/m0/s1 |
| InChIKey | ZLVOSXMICBOOHQ-ZDUSSCGKSA-N |
| XLogP | 4.33 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |