C27H27F3N4O — CID 118969016
(9S)-N-(2-tert-butylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969016) has the molecular formula C27H27F3N4O and a molecular weight of 480.53 g/mol. Its IUPAC name is (9S)-N-(2-tert-butylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(2-tert-butylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969016 |
| Molecular Formula | C27H27F3N4O |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (9S)-N-(2-tert-butylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C27H27F3N4O/c1-26(2,3)20-9-4-5-10-22(20)32-25(35)34-19-13-14-33(16-19)23-12-11-21(31-24(23)34)17-7-6-8-18(15-17)27(28,29)30/h4-12,15,19H,13-14,16H2,1-3H3,(H,32,35)/t19-/m0/s1 |
| InChIKey | LWGBTSNYTSQZRE-IBGZPJMESA-N |
| XLogP | 6.70 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |