C25H20F3N7O — CID 118969378
(9S)-N-[4-(1,2,4-triazol-1-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969378) has the molecular formula C25H20F3N7O and a molecular weight of 491.48 g/mol. Its IUPAC name is (9S)-N-[4-(1,2,4-triazol-1-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(1,2,4-triazol-1-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969378 |
| Molecular Formula | C25H20F3N7O |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (9S)-N-[4-(1,2,4-triazol-1-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)cc1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C25H20F3N7O/c26-25(27,28)17-3-1-2-16(12-17)21-8-9-22-23(32-21)35(20-10-11-33(22)13-20)24(36)31-18-4-6-19(7-5-18)34-15-29-14-30-34/h1-9,12,14-15,20H,10-11,13H2,(H,31,36)/t20-/m0/s1 |
| InChIKey | KZSIQKUSVLOWEN-FQEVSTJZSA-N |
| XLogP | 4.98 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |