C20H16F3N5O — CID 121350557
imidazol-1-yl-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanone (PubChem CID 121350557) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is imidazol-1-yl-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanone.
| Compound Name | imidazol-1-yl-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanone |
|---|---|
| PubChem CID | 121350557 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | imidazol-1-yl-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanone |
| SMILES | O=C(N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2)n1ccnc1 |
| InChI | InChI=1S/C20H16F3N5O/c21-20(22,23)14-3-1-2-13(10-14)16-4-5-17-18(25-16)28(15-6-8-26(17)11-15)19(29)27-9-7-24-12-27/h1-5,7,9-10,12,15H,6,8,11H2/t15-/m0/s1 |
| InChIKey | QNQFPASGJXFVHG-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |