C27H24F3N5O2 — CID 118974529
(9S)-N-[6-(3,6-dihydro-2H-pyran-4-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974529) has the molecular formula C27H24F3N5O2 and a molecular weight of 507.52 g/mol. Its IUPAC name is (9S)-N-[6-(3,6-dihydro-2H-pyran-4-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[6-(3,6-dihydro-2H-pyran-4-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974529 |
| Molecular Formula | C27H24F3N5O2 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (9S)-N-[6-(3,6-dihydro-2H-pyran-4-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(C2=CCOCC2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C27H24F3N5O2/c28-27(29,30)19-4-1-3-18(15-19)22-7-8-23-25(32-22)35(20-9-12-34(23)16-20)26(36)33-24-6-2-5-21(31-24)17-10-13-37-14-11-17/h1-8,10,15,20H,9,11-14,16H2,(H,31,33,36)/t20-/m0/s1 |
| InChIKey | WTCPPEHQBWVTSK-FQEVSTJZSA-N |
| XLogP | 5.60 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |