C23H21F3N6O2 — CID 118124781
N-(6-methoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118124781) has the molecular formula C23H21F3N6O2 and a molecular weight of 470.46 g/mol. Its IUPAC name is N-(6-methoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-(6-methoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118124781 |
| Molecular Formula | C23H21F3N6O2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-(6-methoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CCC2CC3)ncn1 |
| InChI | InChI=1S/C23H21F3N6O2/c1-34-20-12-19(27-13-28-20)30-22(33)32-16-7-9-31(10-8-16)18-6-5-17(29-21(18)32)14-3-2-4-15(11-14)23(24,25)26/h2-6,11-13,16H,7-10H2,1H3,(H,27,28,30,33) |
| InChIKey | FDMXVLRAWULFTL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |