C22H19F3N6O2 — CID 118974231
(6R)-N-(6-methoxypyrimidin-4-yl)-10-[3-(trifluoromethyl)phenyl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide (PubChem CID 118974231) has the molecular formula C22H19F3N6O2 and a molecular weight of 456.43 g/mol. Its IUPAC name is (6R)-N-(6-methoxypyrimidin-4-yl)-10-[3-(trifluoromethyl)phenyl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide.
| Compound Name | (6R)-N-(6-methoxypyrimidin-4-yl)-10-[3-(trifluoromethyl)phenyl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
|---|---|
| PubChem CID | 118974231 |
| Molecular Formula | C22H19F3N6O2 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (6R)-N-(6-methoxypyrimidin-4-yl)-10-[3-(trifluoromethyl)phenyl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
| SMILES | COc1cc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CCC[C@H]32)ncn1 |
| InChI | InChI=1S/C22H19F3N6O2/c1-33-18-11-17(26-12-27-18)29-21(32)31-19-6-3-9-30(19)16-8-7-15(28-20(16)31)13-4-2-5-14(10-13)22(23,24)25/h2,4-5,7-8,10-12,19H,3,6,9H2,1H3,(H,26,27,29,32)/t19-/m1/s1 |
| InChIKey | WNRXDVQYGOLPIL-LJQANCHMSA-N |
| XLogP | 4.54 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |