C22H21F3N6O4 — CID 163719488
(3R)-N-(2,6-dimethoxypyrimidin-4-yl)-3-hydroxy-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 163719488) has the molecular formula C22H21F3N6O4 and a molecular weight of 490.44 g/mol. Its IUPAC name is (3R)-N-(2,6-dimethoxypyrimidin-4-yl)-3-hydroxy-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (3R)-N-(2,6-dimethoxypyrimidin-4-yl)-3-hydroxy-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 163719488 |
| Molecular Formula | C22H21F3N6O4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (3R)-N-(2,6-dimethoxypyrimidin-4-yl)-3-hydroxy-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | COc1cc(NC(=O)N2C[C@H](O)CNc3ccc(-c4cccc(C(F)(F)F)c4)nc32)nc(OC)n1 |
| InChI | InChI=1S/C22H21F3N6O4/c1-34-18-9-17(28-20(30-18)35-2)29-21(33)31-11-14(32)10-26-16-7-6-15(27-19(16)31)12-4-3-5-13(8-12)22(23,24)25/h3-9,14,26,32H,10-11H2,1-2H3,(H,28,29,30,33)/t14-/m1/s1 |
| InChIKey | KQGXWJKJGFIURC-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |