C21H20F3N5OS — CID 118124669
N-(4,5-dimethyl-1,3-thiazol-2-yl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124669) has the molecular formula C21H20F3N5OS and a molecular weight of 447.49 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124669 |
| Molecular Formula | C21H20F3N5OS |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | Cc1nc(NC(=O)N2CCCNc3ccc(-c4cccc(C(F)(F)F)c4)nc32)sc1C |
| InChI | InChI=1S/C21H20F3N5OS/c1-12-13(2)31-19(26-12)28-20(30)29-10-4-9-25-17-8-7-16(27-18(17)29)14-5-3-6-15(11-14)21(22,23)24/h3,5-8,11,25H,4,9-10H2,1-2H3,(H,26,28,30) |
| InChIKey | IBZVOLIFLIAPGZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |