C20H17F3N6O — CID 118124647
N-pyrimidin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124647) has the molecular formula C20H17F3N6O and a molecular weight of 414.39 g/mol. Its IUPAC name is N-pyrimidin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-pyrimidin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124647 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-pyrimidin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | O=C(Nc1cncnc1)N1CCCNc2ccc(-c3cccc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C20H17F3N6O/c21-20(22,23)14-4-1-3-13(9-14)16-5-6-17-18(28-16)29(8-2-7-26-17)19(30)27-15-10-24-12-25-11-15/h1,3-6,9-12,26H,2,7-8H2,(H,27,30) |
| InChIKey | LYIMWYZFKFKFFT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |