C21H20FN5O — CID 118124828
N-(5-fluoro-3-pyridinyl)-7-(3-methylphenyl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124828) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is N-(5-fluoro-3-pyridinyl)-7-(3-methylphenyl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-(5-fluoro-3-pyridinyl)-7-(3-methylphenyl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124828 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(5-fluoro-3-pyridinyl)-7-(3-methylphenyl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | Cc1cccc(-c2ccc3c(n2)N(C(=O)Nc2cncc(F)c2)CCCN3)c1 |
| InChI | InChI=1S/C21H20FN5O/c1-14-4-2-5-15(10-14)18-6-7-19-20(26-18)27(9-3-8-24-19)21(28)25-17-11-16(22)12-23-13-17/h2,4-7,10-13,24H,3,8-9H2,1H3,(H,25,28) |
| InChIKey | YBFYPWASPBIBCQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |