C22H19BrF3N5O — CID 118132992
N-(2-bromo-6-methyl-4-pyridinyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118132992) has the molecular formula C22H19BrF3N5O and a molecular weight of 506.33 g/mol. Its IUPAC name is N-(2-bromo-6-methyl-4-pyridinyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-(2-bromo-6-methyl-4-pyridinyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118132992 |
| Molecular Formula | C22H19BrF3N5O |
| Molecular Weight | 506.33 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | N-(2-bromo-6-methyl-4-pyridinyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCCNc3ccc(-c4cccc(C(F)(F)F)c4)nc32)cc(Br)n1 |
| InChI | InChI=1S/C22H19BrF3N5O/c1-13-10-16(12-19(23)28-13)29-21(32)31-9-3-8-27-18-7-6-17(30-20(18)31)14-4-2-5-15(11-14)22(24,25)26/h2,4-7,10-12,27H,3,8-9H2,1H3,(H,28,29,32) |
| InChIKey | ZPAKFCXGFMSABN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.33 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|