C24H20F6N6O — CID 118133066
N-[3-[3-(trifluoromethyl)diaziridin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118133066) has the molecular formula C24H20F6N6O and a molecular weight of 522.45 g/mol. Its IUPAC name is N-[3-[3-(trifluoromethyl)diaziridin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-[3-[3-(trifluoromethyl)diaziridin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118133066 |
| Molecular Formula | C24H20F6N6O |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-[3-[3-(trifluoromethyl)diaziridin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | O=C(Nc1cccc(C2(C(F)(F)F)NN2)c1)N1CCCNc2ccc(-c3cccc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C24H20F6N6O/c25-23(26,27)16-6-1-4-14(12-16)18-8-9-19-20(33-18)36(11-3-10-31-19)21(37)32-17-7-2-5-15(13-17)22(34-35-22)24(28,29)30/h1-2,4-9,12-13,31,34-35H,3,10-11H2,(H,32,37) |
| InChIKey | SZHPZCBYXFNDRN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|