C26H27F3N4O — CID 118124695
N-(2-tert-butylphenyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124695) has the molecular formula C26H27F3N4O and a molecular weight of 468.52 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124695 |
| Molecular Formula | C26H27F3N4O |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-(2-tert-butylphenyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)N1CCCNc2ccc(-c3cccc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C26H27F3N4O/c1-25(2,3)19-10-4-5-11-21(19)32-24(34)33-15-7-14-30-22-13-12-20(31-23(22)33)17-8-6-9-18(16-17)26(27,28)29/h4-6,8-13,16,30H,7,14-15H2,1-3H3,(H,32,34) |
| InChIKey | UFKIHNUWDLIUCZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |