C25H21F3N6O — CID 118124707
(4R)-4-methyl-N-quinoxalin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124707) has the molecular formula C25H21F3N6O and a molecular weight of 478.48 g/mol. Its IUPAC name is (4R)-4-methyl-N-quinoxalin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (4R)-4-methyl-N-quinoxalin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124707 |
| Molecular Formula | C25H21F3N6O |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (4R)-4-methyl-N-quinoxalin-5-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | C[C@@H]1CCNc2ccc(-c3cccc(C(F)(F)F)c3)nc2N1C(=O)Nc1cccc2nccnc12 |
| InChI | InChI=1S/C25H21F3N6O/c1-15-10-11-29-21-9-8-18(16-4-2-5-17(14-16)25(26,27)28)32-23(21)34(15)24(35)33-20-7-3-6-19-22(20)31-13-12-30-19/h2-9,12-15,29H,10-11H2,1H3,(H,33,35)/t15-/m1/s1 |
| InChIKey | ZPSBRCYKEDPDES-OAHLLOKOSA-N |
| XLogP | 5.95 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |