C25H26F3N5O4 — CID 118133077
(4R)-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-4-methyl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118133077) has the molecular formula C25H26F3N5O4 and a molecular weight of 517.51 g/mol. Its IUPAC name is (4R)-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-4-methyl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (4R)-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-4-methyl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118133077 |
| Molecular Formula | C25H26F3N5O4 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | (4R)-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-4-methyl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | C[C@@H]1CCNc2ccc(-c3cccc(C(F)(F)F)c3)nc2N1C(=O)Nc1cccc(OC[C@H](O)CO)n1 |
| InChI | InChI=1S/C25H26F3N5O4/c1-15-10-11-29-20-9-8-19(16-4-2-5-17(12-16)25(26,27)28)30-23(20)33(15)24(36)32-21-6-3-7-22(31-21)37-14-18(35)13-34/h2-9,12,15,18,29,34-35H,10-11,13-14H2,1H3,(H,31,32,36)/t15-,18-/m1/s1 |
| InChIKey | PNJRYNMIRCTWJN-CRAIPNDOSA-N |
| XLogP | 4.14 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |