C29H32F3N7O2 — CID 118133070
(4R)-4-methyl-N-[4-[[3-(3-methyldiaziridin-3-yl)propanoylamino]methyl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118133070) has the molecular formula C29H32F3N7O2 and a molecular weight of 567.62 g/mol. Its IUPAC name is (4R)-4-methyl-N-[4-[[3-(3-methyldiaziridin-3-yl)propanoylamino]methyl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (4R)-4-methyl-N-[4-[[3-(3-methyldiaziridin-3-yl)propanoylamino]methyl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118133070 |
| Molecular Formula | C29H32F3N7O2 |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | (4R)-4-methyl-N-[4-[[3-(3-methyldiaziridin-3-yl)propanoylamino]methyl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | C[C@@H]1CCNc2ccc(-c3cccc(C(F)(F)F)c3)nc2N1C(=O)Nc1ccc(CNC(=O)CCC2(C)NN2)cc1 |
| InChI | InChI=1S/C29H32F3N7O2/c1-18-13-15-33-24-11-10-23(20-4-3-5-21(16-20)29(30,31)32)36-26(24)39(18)27(41)35-22-8-6-19(7-9-22)17-34-25(40)12-14-28(2)37-38-28/h3-11,16,18,33,37-38H,12-15,17H2,1-2H3,(H,34,40)(H,35,41)/t18-/m1/s1 |
| InChIKey | YCQNQHPJWARDFQ-GOSISDBHSA-N |
| XLogP | 5.23 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|