C35H41F3N6O3 — CID 130437321
(9S)-N-[4-[[6-(pentanoylamino)hexanoylamino]methyl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 130437321) has the molecular formula C35H41F3N6O3 and a molecular weight of 650.75 g/mol. Its IUPAC name is (9S)-N-[4-[[6-(pentanoylamino)hexanoylamino]methyl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-[[6-(pentanoylamino)hexanoylamino]methyl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 130437321 |
| Molecular Formula | C35H41F3N6O3 |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | (9S)-N-[4-[[6-(pentanoylamino)hexanoylamino]methyl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CCCCC(=O)NCCCCCC(=O)NCc1ccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C35H41F3N6O3/c1-2-3-10-31(45)39-19-6-4-5-11-32(46)40-22-24-12-14-27(15-13-24)41-34(47)44-28-18-20-43(23-28)30-17-16-29(42-33(30)44)25-8-7-9-26(21-25)35(36,37)38/h7-9,12-17,21,28H,2-6,10-11,18-20,22-23H2,1H3,(H,39,45)(H,40,46)(H,41,47)/t28-/m0/s1 |
| InChIKey | STORRIJVMOLRQD-NDEPHWFRSA-N |
| XLogP | 6.88 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|