C34H35F3N6O4 — CID 118974630
tert-butyl N-[3-[3-(1,3-oxazol-5-yl)-5-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]propyl]carbamate (PubChem CID 118974630) has the molecular formula C34H35F3N6O4 and a molecular weight of 648.69 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(1,3-oxazol-5-yl)-5-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(1,3-oxazol-5-yl)-5-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 118974630 |
| Molecular Formula | C34H35F3N6O4 |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | tert-butyl N-[3-[3-(1,3-oxazol-5-yl)-5-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)cc(-c2cnco2)c1 |
| InChI | InChI=1S/C34H35F3N6O4/c1-33(2,3)47-32(45)39-12-5-6-21-14-23(29-18-38-20-46-29)17-25(15-21)40-31(44)43-26-11-13-42(19-26)28-10-9-27(41-30(28)43)22-7-4-8-24(16-22)34(35,36)37/h4,7-10,14-18,20,26H,5-6,11-13,19H2,1-3H3,(H,39,45)(H,40,44)/t26-/m0/s1 |
| InChIKey | UPUWJFWIRXCQFX-SANMLTNESA-N |
| XLogP | 7.51 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|