C25H21F3N6O2 — CID 130436976
[[4-(1,3-oxazol-5-yl)-2-pyridinyl]amino]-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol (PubChem CID 130436976) has the molecular formula C25H21F3N6O2 and a molecular weight of 494.48 g/mol. Its IUPAC name is [[4-(1,3-oxazol-5-yl)-2-pyridinyl]amino]-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol.
| Compound Name | [[4-(1,3-oxazol-5-yl)-2-pyridinyl]amino]-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol |
|---|---|
| PubChem CID | 130436976 |
| Molecular Formula | C25H21F3N6O2 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | [[4-(1,3-oxazol-5-yl)-2-pyridinyl]amino]-[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol |
| SMILES | OC(Nc1cc(-c2cnco2)ccn1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C25H21F3N6O2/c26-25(27,28)17-3-1-2-15(10-17)19-4-5-20-23(31-19)34(18-7-9-33(20)13-18)24(35)32-22-11-16(6-8-30-22)21-12-29-14-36-21/h1-6,8,10-12,14,18,24,35H,7,9,13H2,(H,30,32)/t18-,24?/m0/s1 |
| InChIKey | YEABPCMYCKZCNY-VEXWJQHLSA-N |
| XLogP | 4.60 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|