C21H20F3N7O2 — CID 130437414
[(6-methoxypyrimidin-4-yl)amino]-[(9S)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol (PubChem CID 130437414) has the molecular formula C21H20F3N7O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is [(6-methoxypyrimidin-4-yl)amino]-[(9S)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol.
| Compound Name | [(6-methoxypyrimidin-4-yl)amino]-[(9S)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol |
|---|---|
| PubChem CID | 130437414 |
| Molecular Formula | C21H20F3N7O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [(6-methoxypyrimidin-4-yl)amino]-[(9S)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]methanol |
| SMILES | COc1cc(NC(O)N2c3nc(-c4cncc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)ncn1 |
| InChI | InChI=1S/C21H20F3N7O2/c1-33-18-7-17(26-11-27-18)29-20(32)31-14-4-5-30(10-14)16-3-2-15(28-19(16)31)12-6-13(9-25-8-12)21(22,23)24/h2-3,6-9,11,14,20,32H,4-5,10H2,1H3,(H,26,27,29)/t14-,20?/m0/s1 |
| InChIKey | ORYWRROVQLNVNX-PVCZSOGJSA-N |
| XLogP | 2.75 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|