C17H19F3N4 — CID 137401189
5,10-dimethyl-2-[5-(trifluoromethyl)-3-pyridinyl]-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine (PubChem CID 137401189) has the molecular formula C17H19F3N4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 5,10-dimethyl-2-[5-(trifluoromethyl)-3-pyridinyl]-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine.
| Compound Name | 5,10-dimethyl-2-[5-(trifluoromethyl)-3-pyridinyl]-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine |
|---|---|
| PubChem CID | 137401189 |
| Molecular Formula | C17H19F3N4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5,10-dimethyl-2-[5-(trifluoromethyl)-3-pyridinyl]-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine |
| SMILES | CN1CCCCN(C)c2nc(-c3cncc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C17H19F3N4/c1-23-7-3-4-8-24(2)16-15(23)6-5-14(22-16)12-9-13(11-21-10-12)17(18,19)20/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | APMCLRXIURJTQJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |