C25H26F3N5 — CID 137401364
N-[1-[2-[3-(1,1-difluoroethyl)phenyl]-5-methyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]-3-fluoropyridin-4-amine (PubChem CID 137401364) has the molecular formula C25H26F3N5 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[1-[2-[3-(1,1-difluoroethyl)phenyl]-5-methyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]-3-fluoropyridin-4-amine.
| Compound Name | N-[1-[2-[3-(1,1-difluoroethyl)phenyl]-5-methyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]-3-fluoropyridin-4-amine |
|---|---|
| PubChem CID | 137401364 |
| Molecular Formula | C25H26F3N5 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[1-[2-[3-(1,1-difluoroethyl)phenyl]-5-methyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]-3-fluoropyridin-4-amine |
| SMILES | C=C(Nc1ccncc1F)N1CCCCN(C)c2ccc(-c3cccc(C(C)(F)F)c3)nc21 |
| InChI | InChI=1S/C25H26F3N5/c1-17(30-22-11-12-29-16-20(22)26)33-14-5-4-13-32(3)23-10-9-21(31-24(23)33)18-7-6-8-19(15-18)25(2,27)28/h6-12,15-16H,1,4-5,13-14H2,2-3H3,(H,29,30) |
| InChIKey | PUAOCBDCEMGOFC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |