C24H28N6 — CID 137401508
6-methyl-N-[1-[5-methyl-2-(3-methylphenyl)-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]pyrimidin-4-amine (PubChem CID 137401508) has the molecular formula C24H28N6 and a molecular weight of 400.53 g/mol. Its IUPAC name is 6-methyl-N-[1-[5-methyl-2-(3-methylphenyl)-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[1-[5-methyl-2-(3-methylphenyl)-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137401508 |
| Molecular Formula | C24H28N6 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 6-methyl-N-[1-[5-methyl-2-(3-methylphenyl)-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocin-10-yl]ethenyl]pyrimidin-4-amine |
| SMILES | C=C(Nc1cc(C)ncn1)N1CCCCN(C)c2ccc(-c3cccc(C)c3)nc21 |
| InChI | InChI=1S/C24H28N6/c1-17-8-7-9-20(14-17)21-10-11-22-24(28-21)30(13-6-5-12-29(22)4)19(3)27-23-15-18(2)25-16-26-23/h7-11,14-16H,3,5-6,12-13H2,1-2,4H3,(H,25,26,27) |
| InChIKey | LXLXQPXPZIWXDG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |