C23H24N6 — CID 137399812
N-[1-[5-(3-methylphenyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine (PubChem CID 137399812) has the molecular formula C23H24N6 and a molecular weight of 384.49 g/mol. Its IUPAC name is N-[1-[5-(3-methylphenyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine.
| Compound Name | N-[1-[5-(3-methylphenyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 137399812 |
| Molecular Formula | C23H24N6 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-[1-[5-(3-methylphenyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine |
| SMILES | C=C(Nc1cnccn1)N1c2nc(-c3cccc(C)c3)ccc2N2CCC1CC2 |
| InChI | InChI=1S/C23H24N6/c1-16-4-3-5-18(14-16)20-6-7-21-23(27-20)29(19-8-12-28(21)13-9-19)17(2)26-22-15-24-10-11-25-22/h3-7,10-11,14-15,19H,2,8-9,12-13H2,1H3,(H,25,26) |
| InChIKey | QWTPKOFQRLJMHU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |