C19H23F2N3 — CID 137401168
2-[3-(1,1-difluoroethyl)phenyl]-5,10-dimethyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine (PubChem CID 137401168) has the molecular formula C19H23F2N3 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[3-(1,1-difluoroethyl)phenyl]-5,10-dimethyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine.
| Compound Name | 2-[3-(1,1-difluoroethyl)phenyl]-5,10-dimethyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine |
|---|---|
| PubChem CID | 137401168 |
| Molecular Formula | C19H23F2N3 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-[3-(1,1-difluoroethyl)phenyl]-5,10-dimethyl-6,7,8,9-tetrahydropyrido[2,3-b][1,4]diazocine |
| SMILES | CN1CCCCN(C)c2nc(-c3cccc(C(C)(F)F)c3)ccc21 |
| InChI | InChI=1S/C19H23F2N3/c1-19(20,21)15-8-6-7-14(13-15)16-9-10-17-18(22-16)24(3)12-5-4-11-23(17)2/h6-10,13H,4-5,11-12H2,1-3H3 |
| InChIKey | JLPGUSWNOHOEAH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |