C20H21F2N3 — CID 137401403
5-[3-(1,1-difluoroethyl)phenyl]-8-ethenyl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene (PubChem CID 137401403) has the molecular formula C20H21F2N3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-[3-(1,1-difluoroethyl)phenyl]-8-ethenyl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene.
| Compound Name | 5-[3-(1,1-difluoroethyl)phenyl]-8-ethenyl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 137401403 |
| Molecular Formula | C20H21F2N3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-[3-(1,1-difluoroethyl)phenyl]-8-ethenyl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene |
| SMILES | C=CN1c2nc(-c3cccc(C(C)(F)F)c3)ccc2N2CCC1CC2 |
| InChI | InChI=1S/C20H21F2N3/c1-3-25-16-9-11-24(12-10-16)18-8-7-17(23-19(18)25)14-5-4-6-15(13-14)20(2,21)22/h3-8,13,16H,1,9-12H2,2H3 |
| InChIKey | BOXPNZATROTTKV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |