C30H30F3N5O2 — CID 118125157
N-[3-[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118125157) has the molecular formula C30H30F3N5O2 and a molecular weight of 549.60 g/mol. Its IUPAC name is N-[3-[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | N-[3-[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118125157 |
| Molecular Formula | C30H30F3N5O2 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | N-[3-[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]phenyl]-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | O=C(C1CC1)N1CCC(c2cccc(NC(=O)N3CCCNc4ccc(-c5cccc(C(F)(F)F)c5)nc43)c2)C1 |
| InChI | InChI=1S/C30H30F3N5O2/c31-30(32,33)23-6-1-5-21(16-23)25-10-11-26-27(36-25)38(14-3-13-34-26)29(40)35-24-7-2-4-20(17-24)22-12-15-37(18-22)28(39)19-8-9-19/h1-2,4-7,10-11,16-17,19,22,34H,3,8-9,12-15,18H2,(H,35,40) |
| InChIKey | MJDFZQPRCRPYID-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |