C25H23F3N4O — CID 130436991
N-(4,6-dimethyl-2-pyridinyl)-10-[3-(trifluoromethyl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide (PubChem CID 130436991) has the molecular formula C25H23F3N4O and a molecular weight of 452.48 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-10-[3-(trifluoromethyl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-10-[3-(trifluoromethyl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
|---|---|
| PubChem CID | 130436991 |
| Molecular Formula | C25H23F3N4O |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-10-[3-(trifluoromethyl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3C3CCCC32)c1 |
| InChI | InChI=1S/C25H23F3N4O/c1-14-11-15(2)29-22(12-14)31-24(33)32-21-8-4-7-18(21)19-9-10-20(30-23(19)32)16-5-3-6-17(13-16)25(26,27)28/h3,5-6,9-13,18,21H,4,7-8H2,1-2H3,(H,29,31,33) |
| InChIKey | XIXLWRMFPWFVPU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |