C28H27N5O2 — CID 130437267
10-[3-(dimethylamino)phenyl]-N-[3-(1,3-oxazol-5-yl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide (PubChem CID 130437267) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 10-[3-(dimethylamino)phenyl]-N-[3-(1,3-oxazol-5-yl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide.
| Compound Name | 10-[3-(dimethylamino)phenyl]-N-[3-(1,3-oxazol-5-yl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
|---|---|
| PubChem CID | 130437267 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 10-[3-(dimethylamino)phenyl]-N-[3-(1,3-oxazol-5-yl)phenyl]-7,9-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
| SMILES | CN(C)c1cccc(-c2ccc3c(n2)N(C(=O)Nc2cccc(-c4cnco4)c2)C2CCCC32)c1 |
| InChI | InChI=1S/C28H27N5O2/c1-32(2)21-9-4-6-18(15-21)24-13-12-23-22-10-5-11-25(22)33(27(23)31-24)28(34)30-20-8-3-7-19(14-20)26-16-29-17-35-26/h3-4,6-9,12-17,22,25H,5,10-11H2,1-2H3,(H,30,34) |
| InChIKey | QPJCKYJCMJNUGC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |