C25H27N5O3 — CID 145087195
N-(2,3-dihydro-1,4-benzodioxin-6-yl)formamide;8-methyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 145087195) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)formamide;8-methyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)formamide;8-methyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 145087195 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)formamide;8-methyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C)C2CCN3C2)ccn1.O=CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H18N4.C9H9NO3/c1-11-9-12(5-7-17-11)14-3-4-15-16(18-14)19(2)13-6-8-20(15)10-13;11-6-10-7-1-2-8-9(5-7)13-4-3-12-8/h3-5,7,9,13H,6,8,10H2,1-2H3;1-2,5-6H,3-4H2,(H,10,11) |
| InChIKey | IBIZNVLMHMPSDT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|