C21H18N12O — CID 118969516
(9S)-5-[3-azido-5-(azidomethyl)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969516) has the molecular formula C21H18N12O and a molecular weight of 454.46 g/mol. Its IUPAC name is (9S)-5-[3-azido-5-(azidomethyl)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-[3-azido-5-(azidomethyl)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969516 |
| Molecular Formula | C21H18N12O |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (9S)-5-[3-azido-5-(azidomethyl)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | [N-]=[N+]=NCc1cc(N=[N+]=[N-])cc(-c2ccc3c(n2)N(C(=O)Nc2cnccn2)[C@H]2CCN3C2)c1 |
| InChI | InChI=1S/C21H18N12O/c22-30-26-10-13-7-14(9-15(8-13)29-31-23)17-1-2-18-20(27-17)33(16-3-6-32(18)12-16)21(34)28-19-11-24-4-5-25-19/h1-2,4-5,7-9,11,16H,3,6,10,12H2,(H,25,28,34)/t16-/m0/s1 |
| InChIKey | CTHUBWSOKMDCOZ-INIZCTEOSA-N |
| XLogP | 4.92 |
| TPSA | 171.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|