C20H26N8O — CID 118968959
5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118968959) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118968959 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccncn1)N1c2nc(N3CCCNCC3)ccc2N2CCC1CC2 |
| InChI | InChI=1S/C20H26N8O/c29-20(24-17-4-8-22-14-23-17)28-15-5-11-26(12-6-15)16-2-3-18(25-19(16)28)27-10-1-7-21-9-13-27/h2-4,8,14-15,21H,1,5-7,9-13H2,(H,22,23,24,29) |
| InChIKey | HACJQOFQYZENAF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |