C23H30N6O — CID 158229199
(9S)-N-(2,6-dimethyl-4-pyridinyl)-5-(3-methylpiperidin-1-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 158229199) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is (9S)-N-(2,6-dimethyl-4-pyridinyl)-5-(3-methylpiperidin-1-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(2,6-dimethyl-4-pyridinyl)-5-(3-methylpiperidin-1-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 158229199 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (9S)-N-(2,6-dimethyl-4-pyridinyl)-5-(3-methylpiperidin-1-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(NC(=O)N2c3nc(N4CCCC(C)C4)ccc3N3CC[C@H]2C3)cc(C)n1 |
| InChI | InChI=1S/C23H30N6O/c1-15-5-4-9-28(13-15)21-7-6-20-22(26-21)29(19-8-10-27(20)14-19)23(30)25-18-11-16(2)24-17(3)12-18/h6-7,11-12,15,19H,4-5,8-10,13-14H2,1-3H3,(H,24,25,30)/t15?,19-/m0/s1 |
| InChIKey | GEECCGUBXGLHNK-FUBQLUNQSA-N |
| XLogP | 3.96 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |