C21H24F3N7O — CID 130437407
(9R)-N-pyrimidin-2-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 130437407) has the molecular formula C21H24F3N7O and a molecular weight of 447.47 g/mol. Its IUPAC name is (9R)-N-pyrimidin-2-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9R)-N-pyrimidin-2-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 130437407 |
| Molecular Formula | C21H24F3N7O |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (9R)-N-pyrimidin-2-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ncccn1)N1c2nc(N3CCCC(C(F)(F)F)C3)ccc2N2CCC[C@@H]1C2 |
| InChI | InChI=1S/C21H24F3N7O/c22-21(23,24)14-4-1-11-30(12-14)17-7-6-16-18(27-17)31(15-5-2-10-29(16)13-15)20(32)28-19-25-8-3-9-26-19/h3,6-9,14-15H,1-2,4-5,10-13H2,(H,25,26,28,32)/t14?,15-/m1/s1 |
| InChIKey | ILYKYMUJOMNHCY-YSSOQSIOSA-N |
| XLogP | 3.67 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |