C22H27F3N6OS — CID 118974373
(9S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974373) has the molecular formula C22H27F3N6OS and a molecular weight of 480.56 g/mol. Its IUPAC name is (9S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974373 |
| Molecular Formula | C22H27F3N6OS |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (9S)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1nc(NC(=O)N2c3nc(N4CCCC(C(F)(F)F)C4)ccc3N3CCC[C@H]2C3)sc1C |
| InChI | InChI=1S/C22H27F3N6OS/c1-13-14(2)33-20(26-13)28-21(32)31-16-6-4-9-29(12-16)17-7-8-18(27-19(17)31)30-10-3-5-15(11-30)22(23,24)25/h7-8,15-16H,3-6,9-12H2,1-2H3,(H,26,28,32)/t15?,16-/m0/s1 |
| InChIKey | ZGADAGFRTSPVSS-LYKKTTPLSA-N |
| XLogP | 4.95 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |