C22H26F3N5OS — CID 123239643
N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 123239643) has the molecular formula C22H26F3N5OS and a molecular weight of 465.55 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 123239643 |
| Molecular Formula | C22H26F3N5OS |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1nc(NC(=O)N2c3nc(C4CCCC(C(F)(F)F)C4)ccc3N3CCC2C3)sc1C |
| InChI | InChI=1S/C22H26F3N5OS/c1-12-13(2)32-20(26-12)28-21(31)30-16-8-9-29(11-16)18-7-6-17(27-19(18)30)14-4-3-5-15(10-14)22(23,24)25/h6-7,14-16H,3-5,8-11H2,1-2H3,(H,26,28,31) |
| InChIKey | NMSGYKLNNFYCQN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |