C22H23F4N5O — CID 118974226
(9S)-N-(5-fluoro-2-pyridinyl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118974226) has the molecular formula C22H23F4N5O and a molecular weight of 449.45 g/mol. Its IUPAC name is (9S)-N-(5-fluoro-2-pyridinyl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(5-fluoro-2-pyridinyl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118974226 |
| Molecular Formula | C22H23F4N5O |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (9S)-N-(5-fluoro-2-pyridinyl)-5-[3-(trifluoromethyl)cyclohexyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccc(F)cn1)N1c2nc(C3CCCC(C(F)(F)F)C3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C22H23F4N5O/c23-15-4-7-19(27-11-15)29-21(32)31-16-8-9-30(12-16)18-6-5-17(28-20(18)31)13-2-1-3-14(10-13)22(24,25)26/h4-7,11,13-14,16H,1-3,8-10,12H2,(H,27,29,32)/t13?,14?,16-/m0/s1 |
| InChIKey | WVBOBSFKGJLEJT-XUJLQICISA-N |
| XLogP | 5.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |