C19H18F4N6O3 — CID 121352387
(9S)-8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121352387) has the molecular formula C19H18F4N6O3 and a molecular weight of 454.38 g/mol. Its IUPAC name is (9S)-8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352387 |
| Molecular Formula | C19H18F4N6O3 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (9S)-8-N-(5-fluoro-2-pyridinyl)-5-N-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NC[C@@H](O)C(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1ccc(F)cn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C19H18F4N6O3/c20-10-1-4-15(24-7-10)27-18(32)29-11-5-6-28(9-11)13-3-2-12(26-16(13)29)17(31)25-8-14(30)19(21,22)23/h1-4,7,11,14,30H,5-6,8-9H2,(H,25,31)(H,24,27,32)/t11-,14+/m0/s1 |
| InChIKey | KANAMYHTBQEVGO-SMDDNHRTSA-N |
| XLogP | 1.90 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |