C20H20F4N6O2 — CID 140824620
8-N-(5-fluoro-3-methyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824620) has the molecular formula C20H20F4N6O2 and a molecular weight of 452.41 g/mol. Its IUPAC name is 8-N-(5-fluoro-3-methyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(5-fluoro-3-methyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824620 |
| Molecular Formula | C20H20F4N6O2 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 8-N-(5-fluoro-3-methyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1cc(F)cnc1NC(=O)N1c2nc(C(=O)N[C@H](C)C(F)(F)F)ccc2N2CCC1C2 |
| InChI | InChI=1S/C20H20F4N6O2/c1-10-7-12(21)8-25-16(10)28-19(32)30-13-5-6-29(9-13)15-4-3-14(27-17(15)30)18(31)26-11(2)20(22,23)24/h3-4,7-8,11,13H,5-6,9H2,1-2H3,(H,26,31)(H,25,28,32)/t11-,13?/m1/s1 |
| InChIKey | UDNNFMSRQBGRMS-JTDNENJMSA-N |
| XLogP | 3.24 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |