C19H18F3N7O4 — CID 140824638
8-N-(4-nitro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824638) has the molecular formula C19H18F3N7O4 and a molecular weight of 465.39 g/mol. Its IUPAC name is 8-N-(4-nitro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(4-nitro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824638 |
| Molecular Formula | C19H18F3N7O4 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 8-N-(4-nitro-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc([N+](=O)[O-])ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C19H18F3N7O4/c1-10(19(20,21)22)24-17(30)13-2-3-14-16(25-13)28(12-5-7-27(14)9-12)18(31)26-15-8-11(29(32)33)4-6-23-15/h2-4,6,8,10,12H,5,7,9H2,1H3,(H,24,30)(H,23,26,31)/t10-,12?/m1/s1 |
| InChIKey | SITVXNLHLDRMST-RWANSRKNSA-N |
| XLogP | 2.70 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|