C20H19BrF3N5O2 — CID 158507020
(9S)-N-(4-bromo-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 158507020) has the molecular formula C20H19BrF3N5O2 and a molecular weight of 498.30 g/mol. Its IUPAC name is (9S)-N-(4-bromo-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-bromo-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 158507020 |
| Molecular Formula | C20H19BrF3N5O2 |
| Molecular Weight | 498.30 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (9S)-N-(4-bromo-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C[C@H](CC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(Br)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H19BrF3N5O2/c1-11(20(22,23)24)8-16(30)14-2-3-15-18(26-14)29(13-5-7-28(15)10-13)19(31)27-17-9-12(21)4-6-25-17/h2-4,6,9,11,13H,5,7-8,10H2,1H3,(H,25,27,31)/t11-,13+/m1/s1 |
| InChIKey | KNPICVAKDCEUBP-YPMHNXCESA-N |
| XLogP | 4.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |