C19H19F3N6O2 — CID 157163356
(9S)-N-(4-amino-2-pyridinyl)-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 157163356) has the molecular formula C19H19F3N6O2 and a molecular weight of 420.40 g/mol. Its IUPAC name is (9S)-N-(4-amino-2-pyridinyl)-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-amino-2-pyridinyl)-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 157163356 |
| Molecular Formula | C19H19F3N6O2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (9S)-N-(4-amino-2-pyridinyl)-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Nc1ccnc(NC(=O)N2c3nc(C(=O)CCC(F)(F)F)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C19H19F3N6O2/c20-19(21,22)6-3-15(29)13-1-2-14-17(25-13)28(12-5-8-27(14)10-12)18(30)26-16-9-11(23)4-7-24-16/h1-2,4,7,9,12H,3,5-6,8,10H2,(H3,23,24,26,30)/t12-/m0/s1 |
| InChIKey | FRPGYUILVDVXIX-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |