C21H21F3N6O3 — CID 160735950
(9S)-N-[5-(methylcarbamoyl)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 160735950) has the molecular formula C21H21F3N6O3 and a molecular weight of 462.43 g/mol. Its IUPAC name is (9S)-N-[5-(methylcarbamoyl)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[5-(methylcarbamoyl)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 160735950 |
| Molecular Formula | C21H21F3N6O3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (9S)-N-[5-(methylcarbamoyl)-2-pyridinyl]-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)N2c3nc(C(=O)CCC(F)(F)F)ccc3N3CC[C@H]2C3)nc1 |
| InChI | InChI=1S/C21H21F3N6O3/c1-25-19(32)12-2-5-17(26-10-12)28-20(33)30-13-7-9-29(11-13)15-4-3-14(27-18(15)30)16(31)6-8-21(22,23)24/h2-5,10,13H,6-9,11H2,1H3,(H,25,32)(H,26,28,33)/t13-/m0/s1 |
| InChIKey | KNOYVNZUDQWVNK-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |