C19H18F3N7O3 — CID 140824668
8-N-(5-carbamoyl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824668) has the molecular formula C19H18F3N7O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is 8-N-(5-carbamoyl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(5-carbamoyl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824668 |
| Molecular Formula | C19H18F3N7O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 8-N-(5-carbamoyl-2-pyridinyl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)N2c3nc(C(=O)NCC(F)(F)F)ccc3N3CCC2C3)nc1 |
| InChI | InChI=1S/C19H18F3N7O3/c20-19(21,22)9-25-17(31)12-2-3-13-16(26-12)29(11-5-6-28(13)8-11)18(32)27-14-4-1-10(7-24-14)15(23)30/h1-4,7,11H,5-6,8-9H2,(H2,23,30)(H,25,31)(H,24,27,32) |
| InChIKey | CYFWCWJBXGHYHE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |