C18H16ClF3N6O2 — CID 121357989
(9S)-4-chloro-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5,8-dicarboxamide (PubChem CID 121357989) has the molecular formula C18H16ClF3N6O2 and a molecular weight of 440.81 g/mol. Its IUPAC name is (9S)-4-chloro-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5,8-dicarboxamide.
| Compound Name | (9S)-4-chloro-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121357989 |
| Molecular Formula | C18H16ClF3N6O2 |
| Molecular Weight | 440.81 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (9S)-4-chloro-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5,8-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1nc2c(cc1Cl)N1CC[C@@H](C1)N2C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C18H16ClF3N6O2/c19-11-7-12-15(26-14(11)16(29)24-9-18(20,21)22)28(10-4-6-27(12)8-10)17(30)25-13-3-1-2-5-23-13/h1-3,5,7,10H,4,6,8-9H2,(H,24,29)(H,23,25,30)/t10-/m0/s1 |
| InChIKey | GHDXEHDFOZPKKL-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |