C23H20ClF3N6O3 — CID 121359631
(9S)-4-chloro-N-[2-(2-hydroxyethoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359631) has the molecular formula C23H20ClF3N6O3 and a molecular weight of 520.90 g/mol. Its IUPAC name is (9S)-4-chloro-N-[2-(2-hydroxyethoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[2-(2-hydroxyethoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359631 |
| Molecular Formula | C23H20ClF3N6O3 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | (9S)-4-chloro-N-[2-(2-hydroxyethoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OCCO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C23H20ClF3N6O3/c24-16-11-17-20(31-19(16)13-2-1-3-14(10-13)23(25,26)27)33(15-5-7-32(17)12-15)22(35)30-18-4-6-28-21(29-18)36-9-8-34/h1-4,6,10-11,15,34H,5,7-9,12H2,(H,28,29,30,35)/t15-/m0/s1 |
| InChIKey | CGDQDWOHWUQWLH-HNNXBMFYSA-N |
| XLogP | 4.21 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |