C29H29ClF3N5O4 — CID 121350483
(9S)-4-chloro-N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350483) has the molecular formula C29H29ClF3N5O4 and a molecular weight of 604.03 g/mol. Its IUPAC name is (9S)-4-chloro-N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350483 |
| Molecular Formula | C29H29ClF3N5O4 |
| Molecular Weight | 604.03 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | (9S)-4-chloro-N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(OCCOC2CCCCO2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C29H29ClF3N5O4/c30-21-16-22-27(36-26(21)18-5-3-6-19(15-18)29(31,32)33)38(20-10-11-37(22)17-20)28(39)35-23-7-4-8-24(34-23)40-13-14-42-25-9-1-2-12-41-25/h3-8,15-16,20,25H,1-2,9-14,17H2,(H,34,35,39)/t20-,25?/m0/s1 |
| InChIKey | DSNAOQKYYLYMBJ-JINQPTGOSA-N |
| XLogP | 6.37 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.03 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|