C30H33ClF3N5O4 — CID 145083733
4-chloro-8-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]formamide (PubChem CID 145083733) has the molecular formula C30H33ClF3N5O4 and a molecular weight of 620.07 g/mol. Its IUPAC name is 4-chloro-8-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]formamide.
| Compound Name | 4-chloro-8-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 145083733 |
| Molecular Formula | C30H33ClF3N5O4 |
| Molecular Weight | 620.07 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | 4-chloro-8-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene;N-[6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]formamide |
| SMILES | CN1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CCC1C2.O=CNc1cccc(OCCOC2CCCCO2)n1 |
| InChI | InChI=1S/C17H15ClF3N3.C13H18N2O4/c1-23-12-5-6-24(9-12)14-8-13(18)15(22-16(14)23)10-3-2-4-11(7-10)17(19,20)21;16-10-14-11-4-3-5-12(15-11)17-8-9-19-13-6-1-2-7-18-13/h2-4,7-8,12H,5-6,9H2,1H3;3-5,10,13H,1-2,6-9H2,(H,14,15,16) |
| InChIKey | GFGHZKBOQQGFKC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|