C29H33F3N6O4 — CID 145083576
4-ethyl-N-[2-[3-(2-hydroxypropan-2-yloxy)propoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 145083576) has the molecular formula C29H33F3N6O4 and a molecular weight of 586.62 g/mol. Its IUPAC name is 4-ethyl-N-[2-[3-(2-hydroxypropan-2-yloxy)propoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 4-ethyl-N-[2-[3-(2-hydroxypropan-2-yloxy)propoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 145083576 |
| Molecular Formula | C29H33F3N6O4 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 4-ethyl-N-[2-[3-(2-hydroxypropan-2-yloxy)propoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CCc1cc2c(nc1-c1cccc(C(F)(F)F)c1)N(C(=O)Nc1cnc(OCCCOC(C)(C)O)nc1)C1CCN2C1 |
| InChI | InChI=1S/C29H33F3N6O4/c1-4-18-14-23-25(36-24(18)19-7-5-8-20(13-19)29(30,31)32)38(22-9-10-37(23)17-22)27(39)35-21-15-33-26(34-16-21)41-11-6-12-42-28(2,3)40/h5,7-8,13-16,22,40H,4,6,9-12,17H2,1-3H3,(H,35,39) |
| InChIKey | HWBLRTNVYKMCSP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|